C33H44N2O3Si — CID 89165088
(2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide (PubChem CID 89165088) has the molecular formula C33H44N2O3Si and a molecular weight of 544.81 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide |
|---|---|
| PubChem CID | 89165088 |
| Molecular Formula | C33H44N2O3Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide |
| SMILES | C#CC(=O)N[C@H](C(=O)N/C=C\C[C@H](C/C=C\C)CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H44N2O3Si/c1-8-10-18-26(19-17-24-34-31(37)30(32(3,4)5)35-29(36)9-2)25-33(6,7)39(38,27-20-13-11-14-21-27)28-22-15-12-16-23-28/h2,8,10-17,20-24,26,30,38H,18-19,25H2,1,3-7H3,(H,34,37)(H,35,36)/b10-8-,24-17-/t26-,30+/m0/s1 |
| InChIKey | NUKVVNMBPIVKFH-LTSHNWFMSA-N |
| XLogP | 4.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|