C30H45NSi — CID 89165196
N-ethyl-2-methyl-N-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-bis(4-methylphenyl)silyl]propan-2-amine (PubChem CID 89165196) has the molecular formula C30H45NSi and a molecular weight of 447.78 g/mol. Its IUPAC name is N-ethyl-2-methyl-N-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-bis(4-methylphenyl)silyl]propan-2-amine.
| Compound Name | N-ethyl-2-methyl-N-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-bis(4-methylphenyl)silyl]propan-2-amine |
|---|---|
| PubChem CID | 89165196 |
| Molecular Formula | C30H45NSi |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | N-ethyl-2-methyl-N-[(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-bis(4-methylphenyl)silyl]propan-2-amine |
| SMILES | CCN(C(C)(C)C)[Si](c1ccc(C)cc1)(c1ccc(C)cc1)C1C(C)CC2CCCCC21 |
| InChI | InChI=1S/C30H45NSi/c1-8-31(30(5,6)7)32(26-17-13-22(2)14-18-26,27-19-15-23(3)16-20-27)29-24(4)21-25-11-9-10-12-28(25)29/h13-20,24-25,28-29H,8-12,21H2,1-7H3 |
| InChIKey | CSKIVADVZHCFEX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|