About 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine
1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine (PubChem CID 89165342) has the molecular formula C8H13FN2O
and a molecular weight of 172.20 g/mol. Its IUPAC name is 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine.
Molecular Properties
| Compound Name | 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine |
| PubChem CID | 89165342 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine |
| SMILES | CONNCC1=CC=CCC1F |
| InChI | InChI=1S/C8H13FN2O/c1-12-11-10-6-7-4-2-3-5-8(7)9/h2-4,8,10-11H,5-6H2,1H3 |
| InChIKey | LUJJXUSMZOLLHM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine?
The IUPAC name of 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine (CID 89165342) is 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine.
What is the SMILES notation for 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine?
The canonical SMILES for 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine is CONNCC1=CC=CCC1F.
What is the InChIKey of 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine?
The InChIKey is LUJJXUSMZOLLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2O/c1-12-11-10-6-7-4-2-3-5-8(7)9/h2-4,8,10-11H,5-6H2,1H3.
What are the key properties of 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine?
1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine has a molecular weight of 172.20 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-fluorocyclohexa-1,3-dien-1-yl)methyl]-2-methoxyhydrazine is sourced from PubChem (CID 89165342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).