About 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine
2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine (PubChem CID 89165589) has the molecular formula C14H14ClF3N6
and a molecular weight of 358.76 g/mol. Its IUPAC name is 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine |
| PubChem CID | 89165589 |
| Molecular Formula | C14H14ClF3N6 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine |
| SMILES | Cc1nc(Cl)nc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C14H14ClF3N6/c1-9-20-12(15)22-13(21-9)24-7-5-23(6-8-24)11-10(14(16,17)18)3-2-4-19-11/h2-4H,5-8H2,1H3 |
| InChIKey | FDQCNIBMOPDIQQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine?
The IUPAC name of 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine (CID 89165589) is 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine is Cc1nc(Cl)nc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1.
What is the InChIKey of 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine?
The InChIKey is FDQCNIBMOPDIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF3N6/c1-9-20-12(15)22-13(21-9)24-7-5-23(6-8-24)11-10(14(16,17)18)3-2-4-19-11/h2-4H,5-8H2,1H3.
What are the key properties of 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine?
2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine has a molecular weight of 358.76 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1,3,5-triazine is sourced from PubChem (CID 89165589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).