About 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol
4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol (PubChem CID 89165670) has the molecular formula C16H15NS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol.
Molecular Properties
| Compound Name | 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol |
| PubChem CID | 89165670 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol |
| SMILES | Nc1ccc(/C=C/C=C/c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C16H15NS/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h1-12,18H,17H2/b3-1+,4-2+ |
| InChIKey | GJSCVFBNBSGRGU-ZPUQHVIOSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol?
The IUPAC name of 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol (CID 89165670) is 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol.
What is the SMILES notation for 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol?
The canonical SMILES for 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol is Nc1ccc(/C=C/C=C/c2ccc(S)cc2)cc1.
What is the InChIKey of 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol?
The InChIKey is GJSCVFBNBSGRGU-ZPUQHVIOSA-N. The full InChI is InChI=1S/C16H15NS/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h1-12,18H,17H2/b3-1+,4-2+.
What are the key properties of 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol?
4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol has a molecular weight of 253.37 g/mol, XLogP of 4.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]benzenethiol is sourced from PubChem (CID 89165670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).