C7H9F3N2 — CID 89165897
(E)-[(3Z)-1,1,1-trifluoro-5-methylhexa-3,5-dien-2-ylidene]hydrazine (PubChem CID 89165897) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is (E)-[(3Z)-1,1,1-trifluoro-5-methylhexa-3,5-dien-2-ylidene]hydrazine.
| Compound Name | (E)-[(3Z)-1,1,1-trifluoro-5-methylhexa-3,5-dien-2-ylidene]hydrazine |
|---|---|
| PubChem CID | 89165897 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (E)-[(3Z)-1,1,1-trifluoro-5-methylhexa-3,5-dien-2-ylidene]hydrazine |
| SMILES | C=C(C)/C=C\C(=N/N)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-5(2)3-4-6(12-11)7(8,9)10/h3-4H,1,11H2,2H3/b4-3-,12-6+ |
| InChIKey | VTUCHEDXSFKNNY-PRIXUFLXSA-N |
| XLogP | 2.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|