C14H22S — CID 89165931
4-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-methyl-3,4-dihydro-2H-thiopyran (PubChem CID 89165931) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 4-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-methyl-3,4-dihydro-2H-thiopyran.
| Compound Name | 4-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-methyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 89165931 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-ethyl-6-[(2E,4Z)-hexa-2,4-dien-2-yl]-3-methyl-3,4-dihydro-2H-thiopyran |
| SMILES | C/C=C\C=C(/C)C1=CC(CC)C(C)CS1 |
| InChI | InChI=1S/C14H22S/c1-5-7-8-11(3)14-9-13(6-2)12(4)10-15-14/h5,7-9,12-13H,6,10H2,1-4H3/b7-5-,11-8+ |
| InChIKey | BDBDGOCYXSZUME-UKJSTWFMSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|