About 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone
1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 89166052) has the molecular formula C8H8I2O
and a molecular weight of 373.96 g/mol. Its IUPAC name is 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone |
| PubChem CID | 89166052 |
| Molecular Formula | C8H8I2O |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC(I)=CC(I)C1 |
| InChI | InChI=1S/C8H8I2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2,4,8H,3H2,1H3 |
| InChIKey | MWXQUGGSMFEVBP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone?
The IUPAC name of 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone (CID 89166052) is 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone.
What is the SMILES notation for 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone?
The canonical SMILES for 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone is CC(=O)C1=CC(I)=CC(I)C1.
What is the InChIKey of 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone?
The InChIKey is MWXQUGGSMFEVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8I2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2,4,8H,3H2,1H3.
What are the key properties of 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone?
1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone has a molecular weight of 373.96 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-diiodocyclohexa-1,3-dien-1-yl)ethanone is sourced from PubChem (CID 89166052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).