About (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine
(4-methylphenyl)-(1,2-oxazol-3-yl)methanimine (PubChem CID 89166139) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine.
Molecular Properties
| Compound Name | (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine |
| PubChem CID | 89166139 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine |
| SMILES | [H]/N=C(/c1ccc(C)cc1)c1ccon1 |
| InChI | InChI=1S/C11H10N2O/c1-8-2-4-9(5-3-8)11(12)10-6-7-14-13-10/h2-7,12H,1H3/b12-11- |
| InChIKey | WVVWEZXVSQVANX-QXMHVHEDSA-N |
| XLogP | 2.40 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine?
The IUPAC name of (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine (CID 89166139) is (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine.
What is the SMILES notation for (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine?
The canonical SMILES for (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine is [H]/N=C(/c1ccc(C)cc1)c1ccon1.
What is the InChIKey of (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine?
The InChIKey is WVVWEZXVSQVANX-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H10N2O/c1-8-2-4-9(5-3-8)11(12)10-6-7-14-13-10/h2-7,12H,1H3/b12-11-.
What are the key properties of (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine?
(4-methylphenyl)-(1,2-oxazol-3-yl)methanimine has a molecular weight of 186.21 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-(1,2-oxazol-3-yl)methanimine is sourced from PubChem (CID 89166139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).