C14H15Cl2N3O2S — CID 89166172
N-(2,5-diaminophenyl)-2-(3,4-dichlorophenyl)ethanesulfonamide (PubChem CID 89166172) has the molecular formula C14H15Cl2N3O2S and a molecular weight of 360.27 g/mol. Its IUPAC name is N-(2,5-diaminophenyl)-2-(3,4-dichlorophenyl)ethanesulfonamide.
| Compound Name | N-(2,5-diaminophenyl)-2-(3,4-dichlorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 89166172 |
| Molecular Formula | C14H15Cl2N3O2S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-(2,5-diaminophenyl)-2-(3,4-dichlorophenyl)ethanesulfonamide |
| SMILES | Nc1ccc(N)c(NS(=O)(=O)CCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H15Cl2N3O2S/c15-11-3-1-9(7-12(11)16)5-6-22(20,21)19-14-8-10(17)2-4-13(14)18/h1-4,7-8,19H,5-6,17-18H2 |
| InChIKey | VNHQCIPFFIRCLZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|