About 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol
2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol (PubChem CID 89166248) has the molecular formula C11H17ClO3
and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol |
| PubChem CID | 89166248 |
| Molecular Formula | C11H17ClO3 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol |
| SMILES | CC1=C(OC(O)CCl)C(C)CC(CO)=C1 |
| InChI | InChI=1S/C11H17ClO3/c1-7-3-9(6-13)4-8(2)11(7)15-10(14)5-12/h3,8,10,13-14H,4-6H2,1-2H3 |
| InChIKey | TWRIMCGPZYKPLB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol?
The IUPAC name of 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol (CID 89166248) is 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol.
What is the SMILES notation for 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol?
The canonical SMILES for 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol is CC1=C(OC(O)CCl)C(C)CC(CO)=C1.
What is the InChIKey of 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol?
The InChIKey is TWRIMCGPZYKPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClO3/c1-7-3-9(6-13)4-8(2)11(7)15-10(14)5-12/h3,8,10,13-14H,4-6H2,1-2H3.
What are the key properties of 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol?
2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol has a molecular weight of 232.71 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[4-(hydroxymethyl)-2,6-dimethylcyclohexa-1,3-dien-1-yl]oxyethanol is sourced from PubChem (CID 89166248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).