About (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide
(3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide (PubChem CID 89166343) has the molecular formula C12H10F7NO
and a molecular weight of 317.20 g/mol. Its IUPAC name is (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide.
Molecular Properties
| Compound Name | (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide |
| PubChem CID | 89166343 |
| Molecular Formula | C12H10F7NO |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide |
| SMILES | C[C@@](F)(CC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F7NO/c1-10(13,5-9(20)21)6-2-7(11(14,15)16)4-8(3-6)12(17,18)19/h2-4H,5H2,1H3,(H2,20,21)/t10-/m1/s1 |
| InChIKey | IMVOYHXEOPUATI-SNVBAGLBSA-N |
| XLogP | 3.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide?
The IUPAC name of (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide (CID 89166343) is (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide.
What is the SMILES notation for (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide?
The canonical SMILES for (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide is C[C@@](F)(CC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide?
The InChIKey is IMVOYHXEOPUATI-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H10F7NO/c1-10(13,5-9(20)21)6-2-7(11(14,15)16)4-8(3-6)12(17,18)19/h2-4H,5H2,1H3,(H2,20,21)/t10-/m1/s1.
What are the key properties of (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide?
(3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide has a molecular weight of 317.20 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[3,5-bis(trifluoromethyl)phenyl]-3-fluorobutanamide is sourced from PubChem (CID 89166343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).