About 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine
3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine (PubChem CID 89166794) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 89166794 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(N)C=CC1S(C)(=O)=O |
| InChI | InChI=1S/C8H13NO2S/c1-6-5-7(9)3-4-8(6)12(2,10)11/h3-6,8H,9H2,1-2H3 |
| InChIKey | XVTKNUZMWCHDFO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine (CID 89166794) is 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine is CC1C=C(N)C=CC1S(C)(=O)=O.
What is the InChIKey of 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The InChIKey is XVTKNUZMWCHDFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-6-5-7(9)3-4-8(6)12(2,10)11/h3-6,8H,9H2,1-2H3.
What are the key properties of 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine has a molecular weight of 187.26 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-methylsulfonylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 89166794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).