About 7,7a-dihydro-1,2,3-benzoxadiazole
7,7a-dihydro-1,2,3-benzoxadiazole (PubChem CID 89166855) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 7,7a-dihydro-1,2,3-benzoxadiazole.
Molecular Properties
| Compound Name | 7,7a-dihydro-1,2,3-benzoxadiazole |
| PubChem CID | 89166855 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 7,7a-dihydro-1,2,3-benzoxadiazole |
| SMILES | C1=CCC2ON=NC2=C1 |
| InChI | InChI=1S/C6H6N2O/c1-2-4-6-5(3-1)7-8-9-6/h1-3,6H,4H2 |
| InChIKey | DSXCVXSNFVVJPN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,7a-dihydro-1,2,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydro-1,2,3-benzoxadiazole?
The IUPAC name of 7,7a-dihydro-1,2,3-benzoxadiazole (CID 89166855) is 7,7a-dihydro-1,2,3-benzoxadiazole.
What is the SMILES notation for 7,7a-dihydro-1,2,3-benzoxadiazole?
The canonical SMILES for 7,7a-dihydro-1,2,3-benzoxadiazole is C1=CCC2ON=NC2=C1.
What is the InChIKey of 7,7a-dihydro-1,2,3-benzoxadiazole?
The InChIKey is DSXCVXSNFVVJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-2-4-6-5(3-1)7-8-9-6/h1-3,6H,4H2.
What are the key properties of 7,7a-dihydro-1,2,3-benzoxadiazole?
7,7a-dihydro-1,2,3-benzoxadiazole has a molecular weight of 122.13 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydro-1,2,3-benzoxadiazole is sourced from PubChem (CID 89166855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).