C33H34N4O6 — CID 89166905
(2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-amino-6-imino-2,7-dimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate (PubChem CID 89166905) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-amino-6-imino-2,7-dimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-amino-6-imino-2,7-dimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
|---|---|
| PubChem CID | 89166905 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-amino-6-imino-2,7-dimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
| SMILES | [H]/N=c1\cc2oc3cc(N)c(C)cc3c(-c3ccccc3C(=O)N(C)CCCCCC(=O)ON3C(=O)CCC3=O)c-2cc1C |
| InChI | InChI=1S/C33H34N4O6/c1-19-15-23-27(17-25(19)34)42-28-18-26(35)20(2)16-24(28)32(23)21-9-6-7-10-22(21)33(41)36(3)14-8-4-5-11-31(40)43-37-29(38)12-13-30(37)39/h6-7,9-10,15-18,34H,4-5,8,11-14,35H2,1-3H3/b34-25+ |
| InChIKey | YIVQVUQPTWUGJN-YQCHCMBFSA-N |
| XLogP | 5.12 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|