C9H11F3N2S — CID 89167186
[(2E,4Z)-3-(trifluoromethyl)hepta-2,4,6-trienyl]thiourea (PubChem CID 89167186) has the molecular formula C9H11F3N2S and a molecular weight of 236.26 g/mol. Its IUPAC name is [(2E,4Z)-3-(trifluoromethyl)hepta-2,4,6-trienyl]thiourea.
| Compound Name | [(2E,4Z)-3-(trifluoromethyl)hepta-2,4,6-trienyl]thiourea |
|---|---|
| PubChem CID | 89167186 |
| Molecular Formula | C9H11F3N2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [(2E,4Z)-3-(trifluoromethyl)hepta-2,4,6-trienyl]thiourea |
| SMILES | C=C/C=C\C(=C/CNC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2S/c1-2-3-4-7(9(10,11)12)5-6-14-8(13)15/h2-5H,1,6H2,(H3,13,14,15)/b4-3-,7-5+ |
| InChIKey | BGPSEISRWNHCTL-QVXLNCAUSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|