C22H29N5OS — CID 8916727
(2R)-N-(1-adamantyl)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 8916727) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is (2R)-N-(1-adamantyl)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-(1-adamantyl)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 8916727 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (2R)-N-(1-adamantyl)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1cccc(C)c1-n1nnnc1S[C@H](C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29N5OS/c1-13-5-4-6-14(2)19(13)27-21(24-25-26-27)29-15(3)20(28)23-22-10-16-7-17(11-22)9-18(8-16)12-22/h4-6,15-18H,7-12H2,1-3H3,(H,23,28)/t15-,16?,17?,18?,22?/m1/s1 |
| InChIKey | GHZGDKBAAIZFTN-NOCBQHASSA-N |
| XLogP | 3.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |