C27H36FN3O — CID 89167362
N-[(5Z,7Z)-5-ethenylnona-5,7-dien-2-yl]-6-[(3Z)-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 89167362) has the molecular formula C27H36FN3O and a molecular weight of 437.60 g/mol. Its IUPAC name is N-[(5Z,7Z)-5-ethenylnona-5,7-dien-2-yl]-6-[(3Z)-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(5Z,7Z)-5-ethenylnona-5,7-dien-2-yl]-6-[(3Z)-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89167362 |
| Molecular Formula | C27H36FN3O |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-[(5Z,7Z)-5-ethenylnona-5,7-dien-2-yl]-6-[(3Z)-5-fluoro-6-methylhepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | C=C/C(=C\C=C/C)CCC(C)NC(=O)c1cn2c(n1)CCC(C(=C)/C=C\C(F)=C(C)C)C2 |
| InChI | InChI=1S/C27H36FN3O/c1-7-9-10-22(8-2)13-12-21(6)29-27(32)25-18-31-17-23(14-16-26(31)30-25)20(5)11-15-24(28)19(3)4/h7-11,15,18,21,23H,2,5,12-14,16-17H2,1,3-4,6H3,(H,29,32)/b9-7-,15-11-,22-10+ |
| InChIKey | MIORGLJYUOGNQJ-CHUAREJASA-N |
| XLogP | 6.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|