C10H14FN — CID 89167830
5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 89167830) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 89167830 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-[(1E)-2-fluorobuta-1,3-dienyl]-4-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=C/C(F)=C\C1=C(C)CCNC1 |
| InChI | InChI=1S/C10H14FN/c1-3-10(11)6-9-7-12-5-4-8(9)2/h3,6,12H,1,4-5,7H2,2H3/b10-6+ |
| InChIKey | CLUBBSBAORCBBB-UXBLZVDNSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|