C10H17NO3 — CID 89167905
(3Z,5E)-8-amino-4,5-dimethoxyocta-1,3,5-trien-3-ol (PubChem CID 89167905) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (3Z,5E)-8-amino-4,5-dimethoxyocta-1,3,5-trien-3-ol.
| Compound Name | (3Z,5E)-8-amino-4,5-dimethoxyocta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89167905 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (3Z,5E)-8-amino-4,5-dimethoxyocta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(OC)\C(=C/CCN)OC |
| InChI | InChI=1S/C10H17NO3/c1-4-8(12)10(14-3)9(13-2)6-5-7-11/h4,6,12H,1,5,7,11H2,2-3H3/b9-6+,10-8- |
| InChIKey | AOIDALAZMCVCRO-BXXMFMFASA-N |
| XLogP | 1.47 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|