About 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile
2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile (PubChem CID 89168074) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile |
| PubChem CID | 89168074 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile |
| SMILES | COC1C=CC(CC#N)=CC1 |
| InChI | InChI=1S/C9H11NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-4,9H,5-6H2,1H3 |
| InChIKey | BMGWLBAAIGYFTP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The IUPAC name of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile (CID 89168074) is 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile.
What is the SMILES notation for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The canonical SMILES for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile is COC1C=CC(CC#N)=CC1.
What is the InChIKey of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The InChIKey is BMGWLBAAIGYFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-4,9H,5-6H2,1H3.
What are the key properties of 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile has a molecular weight of 149.19 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile is sourced from PubChem (CID 89168074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).