C10H14FN5 — CID 89168088
(1E,3E)-4-fluoro-5-hydrazinyl-2-(1-methylimidazol-4-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89168088) has the molecular formula C10H14FN5 and a molecular weight of 223.25 g/mol. Its IUPAC name is (1E,3E)-4-fluoro-5-hydrazinyl-2-(1-methylimidazol-4-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-4-fluoro-5-hydrazinyl-2-(1-methylimidazol-4-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89168088 |
| Molecular Formula | C10H14FN5 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1E,3E)-4-fluoro-5-hydrazinyl-2-(1-methylimidazol-4-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(NN)/C(F)=C\C(=C/N)c1cn(C)cn1 |
| InChI | InChI=1S/C10H14FN5/c1-7(15-13)9(11)3-8(4-12)10-5-16(2)6-14-10/h3-6,15H,1,12-13H2,2H3/b8-4+,9-3+ |
| InChIKey | NZBJZZIUVJZEHS-VBAIDPPHSA-N |
| XLogP | 0.55 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|