About 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde
2-(4H-1,4-benzothiazin-3-yl)acetaldehyde (PubChem CID 89168111) has the molecular formula C10H9NOS
and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde |
| PubChem CID | 89168111 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde |
| SMILES | O=CCC1=CSc2ccccc2N1 |
| InChI | InChI=1S/C10H9NOS/c12-6-5-8-7-13-10-4-2-1-3-9(10)11-8/h1-4,6-7,11H,5H2 |
| InChIKey | LAYRLFFHQJMNPC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde?
The IUPAC name of 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde (CID 89168111) is 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde.
What is the SMILES notation for 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde?
The canonical SMILES for 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde is O=CCC1=CSc2ccccc2N1.
What is the InChIKey of 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde?
The InChIKey is LAYRLFFHQJMNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c12-6-5-8-7-13-10-4-2-1-3-9(10)11-8/h1-4,6-7,11H,5H2.
What are the key properties of 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde?
2-(4H-1,4-benzothiazin-3-yl)acetaldehyde has a molecular weight of 191.26 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4H-1,4-benzothiazin-3-yl)acetaldehyde is sourced from PubChem (CID 89168111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).