C33H42B2N5O4 — CID 89168265
CID 89168265 (PubChem CID 89168265) has the molecular formula C33H42B2N5O4 and a molecular weight of 594.35 g/mol.
| Compound Name | CID 89168265 |
|---|---|
| PubChem CID | 89168265 |
| Molecular Formula | C33H42B2N5O4 |
| Molecular Weight | 594.35 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C[C@@H](OC(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)C(=O)N2CCC(C3CCNCC3)CC2)cc1[B]C |
| InChI | InChI=1S/C33H42B2N5O4/c1-35-27-20-22(6-7-26(27)34)21-30(31(41)38-16-10-24(11-17-38)23-8-14-36-15-9-23)44-33(43)39-18-12-25(13-19-39)40-29-5-3-2-4-28(29)37-32(40)42/h2-7,20,23-25,30,36H,8-19,21H2,1H3,(H,37,42)/t30-/m1/s1 |
| InChIKey | HDFWSHTVKHFOCM-SSEXGKCCSA-N |
| XLogP | 2.12 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|