About 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol
4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol (PubChem CID 89168287) has the molecular formula C13H21BrO2
and a molecular weight of 289.21 g/mol. Its IUPAC name is 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol.
Molecular Properties
| Compound Name | 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol |
| PubChem CID | 89168287 |
| Molecular Formula | C13H21BrO2 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol |
| SMILES | CCC(CC(Br)C1C=CC=CC1)C(O)OC |
| InChI | InChI=1S/C13H21BrO2/c1-3-10(13(15)16-2)9-12(14)11-7-5-4-6-8-11/h4-7,10-13,15H,3,8-9H2,1-2H3 |
| InChIKey | OUFKKOILLRUXLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol?
The IUPAC name of 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol (CID 89168287) is 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol.
What is the SMILES notation for 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol?
The canonical SMILES for 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol is CCC(CC(Br)C1C=CC=CC1)C(O)OC.
What is the InChIKey of 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol?
The InChIKey is OUFKKOILLRUXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrO2/c1-3-10(13(15)16-2)9-12(14)11-7-5-4-6-8-11/h4-7,10-13,15H,3,8-9H2,1-2H3.
What are the key properties of 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol?
4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol has a molecular weight of 289.21 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-4-cyclohexa-2,4-dien-1-yl-2-ethyl-1-methoxybutan-1-ol is sourced from PubChem (CID 89168287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).