C33H38N8O4S — CID 89168868
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-aminophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-propylurea (PubChem CID 89168868) has the molecular formula C33H38N8O4S and a molecular weight of 642.79 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-aminophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-propylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-aminophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 89168868 |
| Molecular Formula | C33H38N8O4S |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-aminophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-propylurea |
| SMILES | CCCN(C(=O)NCc1ccc(OC)cc1)N1CC(=O)N2[C@@H](Cc3ccc(N)cc3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C33H38N8O4S/c1-3-15-39(33(44)36-17-22-9-13-25(45-2)14-10-22)40-20-29(42)41-26(16-21-7-11-24(34)12-8-21)31(43)38(19-28(40)41)18-23-5-4-6-27-30(23)37-32(35)46-27/h4-14,26,28H,3,15-20,34H2,1-2H3,(H2,35,37)(H,36,44)/t26-,28+/m0/s1 |
| InChIKey | ATKHIHNHUWDGDG-XTEPFMGCSA-N |
| XLogP | 3.43 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|