C8H16O3 — CID 89169125
(2S,4R,5R)-2-methoxy-2,5-dimethyloxan-4-ol (PubChem CID 89169125) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2S,4R,5R)-2-methoxy-2,5-dimethyloxan-4-ol.
| Compound Name | (2S,4R,5R)-2-methoxy-2,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 89169125 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2S,4R,5R)-2-methoxy-2,5-dimethyloxan-4-ol |
| SMILES | CO[C@]1(C)C[C@@H](O)[C@H](C)CO1 |
| InChI | InChI=1S/C8H16O3/c1-6-5-11-8(2,10-3)4-7(6)9/h6-7,9H,4-5H2,1-3H3/t6-,7-,8+/m1/s1 |
| InChIKey | GVDRPQHAKKCZKY-PRJMDXOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |