C13H17NO4 — CID 89169206
N-[(2S)-1,5-dioxopentan-2-yl]-4-methoxycyclohexa-2,4-diene-1-carboxamide (PubChem CID 89169206) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[(2S)-1,5-dioxopentan-2-yl]-4-methoxycyclohexa-2,4-diene-1-carboxamide.
| Compound Name | N-[(2S)-1,5-dioxopentan-2-yl]-4-methoxycyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 89169206 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(2S)-1,5-dioxopentan-2-yl]-4-methoxycyclohexa-2,4-diene-1-carboxamide |
| SMILES | COC1=CCC(C(=O)N[C@H](C=O)CCC=O)C=C1 |
| InChI | InChI=1S/C13H17NO4/c1-18-12-6-4-10(5-7-12)13(17)14-11(9-16)3-2-8-15/h4,6-11H,2-3,5H2,1H3,(H,14,17)/t10?,11-/m0/s1 |
| InChIKey | WRWWZRHRLWKYCO-DTIOYNMSSA-N |
| XLogP | 0.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|