About (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one
(3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one (PubChem CID 89169252) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one |
| PubChem CID | 89169252 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one |
| SMILES | C=C(C)/C=C(\C=C(\C)CO)C(C)=O |
| InChI | InChI=1S/C11H16O2/c1-8(2)5-11(10(4)13)6-9(3)7-12/h5-6,12H,1,7H2,2-4H3/b9-6-,11-5+ |
| InChIKey | BFQWXLZPXKGPKF-YHJPOJEASA-N |
| XLogP | 2.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one?
The IUPAC name of (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one (CID 89169252) is (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one.
What is the SMILES notation for (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one?
The canonical SMILES for (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one is C=C(C)/C=C(\C=C(\C)CO)C(C)=O.
What is the InChIKey of (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one?
The InChIKey is BFQWXLZPXKGPKF-YHJPOJEASA-N. The full InChI is InChI=1S/C11H16O2/c1-8(2)5-11(10(4)13)6-9(3)7-12/h5-6,12H,1,7H2,2-4H3/b9-6-,11-5+.
What are the key properties of (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one?
(3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one has a molecular weight of 180.25 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(Z)-3-hydroxy-2-methylprop-1-enyl]-5-methylhexa-3,5-dien-2-one is sourced from PubChem (CID 89169252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).