About 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine
2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine (PubChem CID 89169686) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine |
| PubChem CID | 89169686 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine |
| SMILES | CC/C=C(\CCC)CCCNCC(CC(C)C)NCC |
| InChI | InChI=1S/C18H38N2/c1-6-10-17(11-7-2)12-9-13-19-15-18(20-8-3)14-16(4)5/h10,16,18-20H,6-9,11-15H2,1-5H3/b17-10+ |
| InChIKey | IGVSXIDSWZXZQG-LICLKQGHSA-N |
| XLogP | 4.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine?
The IUPAC name of 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine (CID 89169686) is 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine.
What is the SMILES notation for 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine?
The canonical SMILES for 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine is CC/C=C(\CCC)CCCNCC(CC(C)C)NCC.
What is the InChIKey of 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine?
The InChIKey is IGVSXIDSWZXZQG-LICLKQGHSA-N. The full InChI is InChI=1S/C18H38N2/c1-6-10-17(11-7-2)12-9-13-19-15-18(20-8-3)14-16(4)5/h10,16,18-20H,6-9,11-15H2,1-5H3/b17-10+.
What are the key properties of 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine?
2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine has a molecular weight of 282.52 g/mol, XLogP of 4.52, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-4-methyl-1-N-[(E)-4-propylhept-4-enyl]pentane-1,2-diamine is sourced from PubChem (CID 89169686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).