C23H29IN2O — CID 89169823
N-[[1-[iodomethyl(methyl)amino]cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide (PubChem CID 89169823) has the molecular formula C23H29IN2O and a molecular weight of 476.40 g/mol. Its IUPAC name is N-[[1-[iodomethyl(methyl)amino]cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide.
| Compound Name | N-[[1-[iodomethyl(methyl)amino]cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 89169823 |
| Molecular Formula | C23H29IN2O |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[[1-[iodomethyl(methyl)amino]cyclopentyl]-phenylmethyl]-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NC(c1ccccc1)C1(N(C)CI)CCCC1 |
| InChI | InChI=1S/C23H29IN2O/c1-17-10-9-11-18(2)20(17)22(27)25-21(19-12-5-4-6-13-19)23(26(3)16-24)14-7-8-15-23/h4-6,9-13,21H,7-8,14-16H2,1-3H3,(H,25,27) |
| InChIKey | CKRMJUDRJQXKAA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|