C14H15I — CID 89169979
(9R)-9-iodo-1,2,3,4,9,10-hexahydrophenanthrene (PubChem CID 89169979) has the molecular formula C14H15I and a molecular weight of 310.18 g/mol. Its IUPAC name is (9R)-9-iodo-1,2,3,4,9,10-hexahydrophenanthrene.
| Compound Name | (9R)-9-iodo-1,2,3,4,9,10-hexahydrophenanthrene |
|---|---|
| PubChem CID | 89169979 |
| Molecular Formula | C14H15I |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (9R)-9-iodo-1,2,3,4,9,10-hexahydrophenanthrene |
| SMILES | I[C@@H]1CC2=C(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H15I/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h3-4,7-8,14H,1-2,5-6,9H2/t14-/m1/s1 |
| InChIKey | PAYGQWLFSXEYSG-CQSZACIVSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|