About 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene
2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene (PubChem CID 89170004) has the molecular formula C26H29I
and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene.
Molecular Properties
| Compound Name | 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene |
| PubChem CID | 89170004 |
| Molecular Formula | C26H29I |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene |
| SMILES | C=CCCC(c1ccc2c(c1)C(C)(C)c1cc(I)ccc1-2)C1C=CCCC1 |
| InChI | InChI=1S/C26H29I/c1-4-5-11-21(18-9-7-6-8-10-18)19-12-14-22-23-15-13-20(27)17-25(23)26(2,3)24(22)16-19/h4,7,9,12-18,21H,1,5-6,8,10-11H2,2-3H3 |
| InChIKey | BOGUUQLPSUVIRJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene?
The IUPAC name of 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene (CID 89170004) is 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene.
What is the SMILES notation for 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene?
The canonical SMILES for 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene is C=CCCC(c1ccc2c(c1)C(C)(C)c1cc(I)ccc1-2)C1C=CCCC1.
What is the InChIKey of 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene?
The InChIKey is BOGUUQLPSUVIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29I/c1-4-5-11-21(18-9-7-6-8-10-18)19-12-14-22-23-15-13-20(27)17-25(23)26(2,3)24(22)16-19/h4,7,9,12-18,21H,1,5-6,8,10-11H2,2-3H3.
What are the key properties of 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene?
2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene has a molecular weight of 468.42 g/mol, XLogP of 8.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohex-2-en-1-ylpent-4-enyl)-7-iodo-9,9-dimethylfluorene is sourced from PubChem (CID 89170004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).