About 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide
3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide (PubChem CID 89170025) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide.
Molecular Properties
| Compound Name | 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide |
| PubChem CID | 89170025 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide |
| SMILES | C=C/C=C(C)\N=C(\N)CC(C)C |
| InChI | InChI=1S/C10H18N2/c1-5-6-9(4)12-10(11)7-8(2)3/h5-6,8H,1,7H2,2-4H3,(H2,11,12)/b9-6- |
| InChIKey | DRBAJZPJZRAPLF-TWGQIWQCSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide?
The IUPAC name of 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide (CID 89170025) is 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide.
What is the SMILES notation for 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide?
The canonical SMILES for 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide is C=C/C=C(C)\N=C(\N)CC(C)C.
What is the InChIKey of 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide?
The InChIKey is DRBAJZPJZRAPLF-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-6-9(4)12-10(11)7-8(2)3/h5-6,8H,1,7H2,2-4H3,(H2,11,12)/b9-6-.
What are the key properties of 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide?
3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide has a molecular weight of 166.27 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]butanimidamide is sourced from PubChem (CID 89170025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).