About methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate
methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate (PubChem CID 89170035) has the molecular formula C7H12N2S
and a molecular weight of 156.25 g/mol. Its IUPAC name is methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate |
| PubChem CID | 89170035 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate |
| SMILES | C=C/C=C(C)\N=C(\N)SC |
| InChI | InChI=1S/C7H12N2S/c1-4-5-6(2)9-7(8)10-3/h4-5H,1H2,2-3H3,(H2,8,9)/b6-5- |
| InChIKey | KSXBDPCMYQMZRU-WAYWQWQTSA-N |
| XLogP | 1.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate?
The IUPAC name of methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate (CID 89170035) is methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate.
What is the SMILES notation for methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate?
The canonical SMILES for methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate is C=C/C=C(C)\N=C(\N)SC.
What is the InChIKey of methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate?
The InChIKey is KSXBDPCMYQMZRU-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H12N2S/c1-4-5-6(2)9-7(8)10-3/h4-5H,1H2,2-3H3,(H2,8,9)/b6-5-.
What are the key properties of methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate?
methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate has a molecular weight of 156.25 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[(2Z)-penta-2,4-dien-2-yl]carbamimidothioate is sourced from PubChem (CID 89170035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).