About 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine
1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine (PubChem CID 89170037) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
| PubChem CID | 89170037 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
| SMILES | C=C/C=C(C)\N=C(/N)N(C)CCN(C)C |
| InChI | InChI=1S/C11H22N4/c1-6-7-10(2)13-11(12)15(5)9-8-14(3)4/h6-7H,1,8-9H2,2-5H3,(H2,12,13)/b10-7- |
| InChIKey | QUHZRYYUDHWXHT-YFHOEESVSA-N |
| XLogP | 0.88 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine (CID 89170037) is 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine is C=C/C=C(C)\N=C(/N)N(C)CCN(C)C.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The InChIKey is QUHZRYYUDHWXHT-YFHOEESVSA-N. The full InChI is InChI=1S/C11H22N4/c1-6-7-10(2)13-11(12)15(5)9-8-14(3)4/h6-7H,1,8-9H2,2-5H3,(H2,12,13)/b10-7-.
What are the key properties of 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine has a molecular weight of 210.32 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine is sourced from PubChem (CID 89170037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).