About 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine
1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine (PubChem CID 89170050) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine.
Molecular Properties
| Compound Name | 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine |
| PubChem CID | 89170050 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine |
| SMILES | C=C/C=C(C)\N=C(/N)N(C)C(C)C |
| InChI | InChI=1S/C10H19N3/c1-6-7-9(4)12-10(11)13(5)8(2)3/h6-8H,1H2,2-5H3,(H2,11,12)/b9-7- |
| InChIKey | RABWDDONFNKTBH-CLFYSBASSA-N |
| XLogP | 1.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine?
The IUPAC name of 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine (CID 89170050) is 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine.
What is the SMILES notation for 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine?
The canonical SMILES for 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine is C=C/C=C(C)\N=C(/N)N(C)C(C)C.
What is the InChIKey of 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine?
The InChIKey is RABWDDONFNKTBH-CLFYSBASSA-N. The full InChI is InChI=1S/C10H19N3/c1-6-7-9(4)12-10(11)13(5)8(2)3/h6-8H,1H2,2-5H3,(H2,11,12)/b9-7-.
What are the key properties of 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine?
1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine has a molecular weight of 181.28 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]-1-propan-2-ylguanidine is sourced from PubChem (CID 89170050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).