C11H20N2 — CID 89170105
(1E,3Z)-1-N',1-N'-diethyl-3-methylhexa-1,3,5-triene-1,1-diamine (PubChem CID 89170105) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (1E,3Z)-1-N',1-N'-diethyl-3-methylhexa-1,3,5-triene-1,1-diamine.
| Compound Name | (1E,3Z)-1-N',1-N'-diethyl-3-methylhexa-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 89170105 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (1E,3Z)-1-N',1-N'-diethyl-3-methylhexa-1,3,5-triene-1,1-diamine |
| SMILES | C=C/C=C(C)\C=C(/N)N(CC)CC |
| InChI | InChI=1S/C11H20N2/c1-5-8-10(4)9-11(12)13(6-2)7-3/h5,8-9H,1,6-7,12H2,2-4H3/b10-8-,11-9+ |
| InChIKey | FNEDVGSLGQTTFF-PNQPDEHRSA-N |
| XLogP | 2.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|