C12H16F3N — CID 89170109
(1Z,3Z)-3-methyl-1-[1-(trifluoromethyl)cyclobutyl]hexa-1,3,5-trien-1-amine (PubChem CID 89170109) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is (1Z,3Z)-3-methyl-1-[1-(trifluoromethyl)cyclobutyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-methyl-1-[1-(trifluoromethyl)cyclobutyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89170109 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (1Z,3Z)-3-methyl-1-[1-(trifluoromethyl)cyclobutyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C(/N)C1(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C12H16F3N/c1-3-5-9(2)8-10(16)11(6-4-7-11)12(13,14)15/h3,5,8H,1,4,6-7,16H2,2H3/b9-5-,10-8- |
| InChIKey | JFLJGDLSIZDFBO-UDRCNDPASA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|