C11H17N — CID 89170110
(1Z,3Z)-1-cyclobutyl-3-methylhexa-1,3,5-trien-1-amine (PubChem CID 89170110) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (1Z,3Z)-1-cyclobutyl-3-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-1-cyclobutyl-3-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89170110 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (1Z,3Z)-1-cyclobutyl-3-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C(/N)C1CCC1 |
| InChI | InChI=1S/C11H17N/c1-3-5-9(2)8-11(12)10-6-4-7-10/h3,5,8,10H,1,4,6-7,12H2,2H3/b9-5-,11-8- |
| InChIKey | OOUPDBQYELSREZ-DQIWSBTHSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|