C11H17I — CID 89170112
(3Z,5Z)-7-iodo-2,3,5,6-tetramethylhepta-1,3,5-triene (PubChem CID 89170112) has the molecular formula C11H17I and a molecular weight of 276.16 g/mol. Its IUPAC name is (3Z,5Z)-7-iodo-2,3,5,6-tetramethylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-iodo-2,3,5,6-tetramethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89170112 |
| Molecular Formula | C11H17I |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (3Z,5Z)-7-iodo-2,3,5,6-tetramethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C\C(C)=C(\C)CI |
| InChI | InChI=1S/C11H17I/c1-8(2)9(3)6-10(4)11(5)7-12/h6H,1,7H2,2-5H3/b9-6-,11-10- |
| InChIKey | BYCAJBVGRURZIT-ONEMGQKZSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|