C10H15I — CID 89170152
(3Z,5Z)-7-iodo-2,3,5-trimethylhepta-1,3,5-triene (PubChem CID 89170152) has the molecular formula C10H15I and a molecular weight of 262.13 g/mol. Its IUPAC name is (3Z,5Z)-7-iodo-2,3,5-trimethylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-iodo-2,3,5-trimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89170152 |
| Molecular Formula | C10H15I |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3Z,5Z)-7-iodo-2,3,5-trimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C\C(C)=C/CI |
| InChI | InChI=1S/C10H15I/c1-8(2)10(4)7-9(3)5-6-11/h5,7H,1,6H2,2-4H3/b9-5-,10-7- |
| InChIKey | XFBOLDTUQQXPCZ-IQHOYWBLSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|