C10H17I — CID 89170172
(2Z,4Z)-1-iodo-2,3,5-trimethylhepta-2,4-diene (PubChem CID 89170172) has the molecular formula C10H17I and a molecular weight of 264.15 g/mol. Its IUPAC name is (2Z,4Z)-1-iodo-2,3,5-trimethylhepta-2,4-diene.
| Compound Name | (2Z,4Z)-1-iodo-2,3,5-trimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 89170172 |
| Molecular Formula | C10H17I |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (2Z,4Z)-1-iodo-2,3,5-trimethylhepta-2,4-diene |
| SMILES | CC/C(C)=C\C(C)=C(\C)CI |
| InChI | InChI=1S/C10H17I/c1-5-8(2)6-9(3)10(4)7-11/h6H,5,7H2,1-4H3/b8-6-,10-9- |
| InChIKey | ACSRWMUPNOJYMU-VAOAJWRNSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|