C13H17I — CID 89170181
5-[(2E,4E)-4-iodohepta-2,4-dien-2-yl]cyclohexa-1,3-diene (PubChem CID 89170181) has the molecular formula C13H17I and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-[(2E,4E)-4-iodohepta-2,4-dien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 5-[(2E,4E)-4-iodohepta-2,4-dien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89170181 |
| Molecular Formula | C13H17I |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-[(2E,4E)-4-iodohepta-2,4-dien-2-yl]cyclohexa-1,3-diene |
| SMILES | CC/C=C(I)\C=C(/C)C1C=CC=CC1 |
| InChI | InChI=1S/C13H17I/c1-3-7-13(14)10-11(2)12-8-5-4-6-9-12/h4-8,10,12H,3,9H2,1-2H3/b11-10+,13-7+ |
| InChIKey | ZBIGWIZRBCVRMM-DTICODAZSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|