C14H17I — CID 89170259
(9R,10aR)-9-iodo-3,4,4a,5,6,9,10,10a-octahydrophenanthrene (PubChem CID 89170259) has the molecular formula C14H17I and a molecular weight of 312.19 g/mol. Its IUPAC name is (9R,10aR)-9-iodo-3,4,4a,5,6,9,10,10a-octahydrophenanthrene.
| Compound Name | (9R,10aR)-9-iodo-3,4,4a,5,6,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 89170259 |
| Molecular Formula | C14H17I |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (9R,10aR)-9-iodo-3,4,4a,5,6,9,10,10a-octahydrophenanthrene |
| SMILES | I[C@@H]1C[C@@H]2C=CCCC2C2=C1C=CCC2 |
| InChI | InChI=1S/C14H17I/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1,4-5,8,10-11,14H,2-3,6-7,9H2/t10-,11?,14+/m0/s1 |
| InChIKey | XJMXVCDCGCATBE-PFSRQVJMSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|