About (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine
(6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine (PubChem CID 89170402) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine.
Molecular Properties
| Compound Name | (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine |
| PubChem CID | 89170402 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine |
| SMILES | C=C1/C=C\C=C/CCC/C(C)=N\1 |
| InChI | InChI=1S/C11H15N/c1-10-8-6-4-3-5-7-9-11(2)12-10/h3-4,6,8H,1,5,7,9H2,2H3/b4-3-,8-6-,12-11- |
| InChIKey | YTLYRJKNVPIIAK-FZWNHHNTSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine?
The IUPAC name of (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine (CID 89170402) is (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine.
What is the SMILES notation for (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine?
The canonical SMILES for (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine is C=C1/C=C\C=C/CCC/C(C)=N\1.
What is the InChIKey of (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine?
The InChIKey is YTLYRJKNVPIIAK-FZWNHHNTSA-N. The full InChI is InChI=1S/C11H15N/c1-10-8-6-4-3-5-7-9-11(2)12-10/h3-4,6,8H,1,5,7,9H2,2H3/b4-3-,8-6-,12-11-.
What are the key properties of (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine?
(6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine has a molecular weight of 161.25 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,8Z)-2-methyl-10-methylidene-4,5-dihydro-3H-azecine is sourced from PubChem (CID 89170402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).