C26H31I — CID 89170512
2-[(1S,4Z)-6-iodo-3-methylcyclodec-4-en-1-yl]-9,9-dimethylfluorene (PubChem CID 89170512) has the molecular formula C26H31I and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[(1S,4Z)-6-iodo-3-methylcyclodec-4-en-1-yl]-9,9-dimethylfluorene.
| Compound Name | 2-[(1S,4Z)-6-iodo-3-methylcyclodec-4-en-1-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 89170512 |
| Molecular Formula | C26H31I |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[(1S,4Z)-6-iodo-3-methylcyclodec-4-en-1-yl]-9,9-dimethylfluorene |
| SMILES | CC1/C=C\C(I)CCCC[C@H](c2ccc3c(c2)C(C)(C)c2ccccc2-3)C1 |
| InChI | InChI=1S/C26H31I/c1-18-12-14-21(27)9-5-4-8-19(16-18)20-13-15-23-22-10-6-7-11-24(22)26(2,3)25(23)17-20/h6-7,10-15,17-19,21H,4-5,8-9,16H2,1-3H3/b14-12-/t18?,19-,21?/m0/s1 |
| InChIKey | YDUNIWQZWHJLTR-KWFWFZNXSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|