About 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene
1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene (PubChem CID 89170541) has the molecular formula C20H27I
and a molecular weight of 394.34 g/mol. Its IUPAC name is 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene.
Molecular Properties
| Compound Name | 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene |
| PubChem CID | 89170541 |
| Molecular Formula | C20H27I |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene |
| SMILES | C=CC(C/C=C\C)c1cc(I)cc(/C(=C/CC)CCC)c1 |
| InChI | InChI=1S/C20H27I/c1-5-9-12-16(8-4)18-13-19(15-20(21)14-18)17(10-6-2)11-7-3/h5,8-10,13-16H,4,6-7,11-12H2,1-3H3/b9-5-,17-10+ |
| InChIKey | ZQHVCZZWNIIRRG-BTDIOWSQSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene?
The IUPAC name of 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene (CID 89170541) is 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene.
What is the SMILES notation for 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene?
The canonical SMILES for 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene is C=CC(C/C=C\C)c1cc(I)cc(/C(=C/CC)CCC)c1.
What is the InChIKey of 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene?
The InChIKey is ZQHVCZZWNIIRRG-BTDIOWSQSA-N. The full InChI is InChI=1S/C20H27I/c1-5-9-12-16(8-4)18-13-19(15-20(21)14-18)17(10-6-2)11-7-3/h5,8-10,13-16H,4,6-7,11-12H2,1-3H3/b9-5-,17-10+.
What are the key properties of 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene?
1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene has a molecular weight of 394.34 g/mol, XLogP of 7.12, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z)-hepta-1,5-dien-3-yl]-3-[(E)-hept-3-en-4-yl]-5-iodobenzene is sourced from PubChem (CID 89170541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).