C20H25I — CID 89170656
2-[(2E,4E,7E,9Z)-7-ethenyl-2-iodo-6-methylundeca-2,4,7,9-tetraen-4-yl]cyclohexa-1,3-diene (PubChem CID 89170656) has the molecular formula C20H25I and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-[(2E,4E,7E,9Z)-7-ethenyl-2-iodo-6-methylundeca-2,4,7,9-tetraen-4-yl]cyclohexa-1,3-diene.
| Compound Name | 2-[(2E,4E,7E,9Z)-7-ethenyl-2-iodo-6-methylundeca-2,4,7,9-tetraen-4-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89170656 |
| Molecular Formula | C20H25I |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[(2E,4E,7E,9Z)-7-ethenyl-2-iodo-6-methylundeca-2,4,7,9-tetraen-4-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C(=C\C=C/C)C(C)/C=C(\C=C(/C)I)C1=CCCC=C1 |
| InChI | InChI=1S/C20H25I/c1-5-7-11-18(6-2)16(3)14-20(15-17(4)21)19-12-9-8-10-13-19/h5-7,9,11-16H,2,8,10H2,1,3-4H3/b7-5-,17-15+,18-11+,20-14+ |
| InChIKey | QBLFCWFNPIYMCH-LYSAUUHMSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|