C26H35I — CID 89170763
1-ethenyl-5-iodo-3,3-dimethyl-2-[2-[(4Z,6Z)-8-methylidenecyclodeca-4,6-dien-1-yl]ethyl]-1,2,5,6-tetrahydroindene (PubChem CID 89170763) has the molecular formula C26H35I and a molecular weight of 474.47 g/mol. Its IUPAC name is 1-ethenyl-5-iodo-3,3-dimethyl-2-[2-[(4Z,6Z)-8-methylidenecyclodeca-4,6-dien-1-yl]ethyl]-1,2,5,6-tetrahydroindene.
| Compound Name | 1-ethenyl-5-iodo-3,3-dimethyl-2-[2-[(4Z,6Z)-8-methylidenecyclodeca-4,6-dien-1-yl]ethyl]-1,2,5,6-tetrahydroindene |
|---|---|
| PubChem CID | 89170763 |
| Molecular Formula | C26H35I |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-ethenyl-5-iodo-3,3-dimethyl-2-[2-[(4Z,6Z)-8-methylidenecyclodeca-4,6-dien-1-yl]ethyl]-1,2,5,6-tetrahydroindene |
| SMILES | C=CC1C2=CCC(I)C=C2C(C)(C)C1CCC1CC/C=C\C=C/C(=C)CC1 |
| InChI | InChI=1S/C26H35I/c1-5-22-23-16-15-21(27)18-25(23)26(3,4)24(22)17-14-20-11-9-7-6-8-10-19(2)12-13-20/h5-8,10,16,18,20-22,24H,1-2,9,11-15,17H2,3-4H3/b7-6-,10-8- |
| InChIKey | KVWWIMAVPJNLOQ-INZNQPOWSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|